C17H22N4O4S — CID 55838977
3,4-dimethoxy-N'-[2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]amino]acetyl]benzohydrazide (PubChem CID 55838977) has the molecular formula C17H22N4O4S and a molecular weight of 378.45 g/mol. Its IUPAC name is 3,4-dimethoxy-N'-[2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]amino]acetyl]benzohydrazide.
| Compound Name | 3,4-dimethoxy-N'-[2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]amino]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 55838977 |
| Molecular Formula | C17H22N4O4S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.14 |
| IUPAC Name | 3,4-dimethoxy-N'-[2-[methyl-[(2-methyl-1,3-thiazol-5-yl)methyl]amino]acetyl]benzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)CN(C)Cc2cnc(C)s2)cc1OC |
| InChI | InChI=1S/C17H22N4O4S/c1-11-18-8-13(26-11)9-21(2)10-16(22)19-20-17(23)12-5-6-14(24-3)15(7-12)25-4/h5-8H,9-10H2,1-4H3,(H,19,22)(H,20,23) |
| InChIKey | SYXKXFVTRPCDQD-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 92.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|