C19H19F3N4O5 — CID 55839736
5-nitro-1-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]ethyl]pyridin-2-one (PubChem CID 55839736) has the molecular formula C19H19F3N4O5 and a molecular weight of 440.38 g/mol. Its IUPAC name is 5-nitro-1-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]ethyl]pyridin-2-one.
| Compound Name | 5-nitro-1-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]ethyl]pyridin-2-one |
|---|---|
| PubChem CID | 55839736 |
| Molecular Formula | C19H19F3N4O5 |
| Molecular Weight | 440.38 g/mol |
| Exact Mass | 440.13 |
| IUPAC Name | 5-nitro-1-[2-oxo-2-[4-[[4-(trifluoromethoxy)phenyl]methyl]piperazin-1-yl]ethyl]pyridin-2-one |
| SMILES | O=C(Cn1cc([N+](=O)[O-])ccc1=O)N1CCN(Cc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H19F3N4O5/c20-19(21,22)31-16-4-1-14(2-5-16)11-23-7-9-24(10-8-23)18(28)13-25-12-15(26(29)30)3-6-17(25)27/h1-6,12H,7-11,13H2 |
| InChIKey | QFRWJYGPRBBCNH-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 97.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.38 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|