C22H23FN2O4 — CID 55840025
N-(2-acetyl-1-benzofuran-3-yl)-2-[2-(3-fluorophenoxy)ethyl-methylamino]propanamide (PubChem CID 55840025) has the molecular formula C22H23FN2O4 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-(2-acetyl-1-benzofuran-3-yl)-2-[2-(3-fluorophenoxy)ethyl-methylamino]propanamide.
| Compound Name | N-(2-acetyl-1-benzofuran-3-yl)-2-[2-(3-fluorophenoxy)ethyl-methylamino]propanamide |
|---|---|
| PubChem CID | 55840025 |
| Molecular Formula | C22H23FN2O4 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-(2-acetyl-1-benzofuran-3-yl)-2-[2-(3-fluorophenoxy)ethyl-methylamino]propanamide |
| SMILES | CC(=O)c1oc2ccccc2c1NC(=O)C(C)N(C)CCOc1cccc(F)c1 |
| InChI | InChI=1S/C22H23FN2O4/c1-14(25(3)11-12-28-17-8-6-7-16(23)13-17)22(27)24-20-18-9-4-5-10-19(18)29-21(20)15(2)26/h4-10,13-14H,11-12H2,1-3H3,(H,24,27) |
| InChIKey | DWWLRBLJHBDUPH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |