C24H23FN2O3 — CID 8516163
(2S)-2-[(3-fluorophenyl)methyl-methylamino]-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 8516163) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is (2S)-2-[(3-fluorophenyl)methyl-methylamino]-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | (2S)-2-[(3-fluorophenyl)methyl-methylamino]-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 8516163 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2S)-2-[(3-fluorophenyl)methyl-methylamino]-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)[C@H](C)N(C)Cc1cccc(F)c1)oc1ccccc12 |
| InChI | InChI=1S/C24H23FN2O3/c1-15(27(2)14-16-7-6-8-17(25)11-16)24(28)26-20-13-22-19(12-23(20)29-3)18-9-4-5-10-21(18)30-22/h4-13,15H,14H2,1-3H3,(H,26,28)/t15-/m0/s1 |
| InChIKey | HIQUXGUNJLYOQN-HNNXBMFYSA-N |
| XLogP | 5.19 |
| TPSA | 54.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |