C24H23FN2O3 — CID 2402948
(2R)-2-[2-(4-fluorophenyl)ethylamino]-N-(2-methoxydibenzofuran-3-yl)propanamide (PubChem CID 2402948) has the molecular formula C24H23FN2O3 and a molecular weight of 406.46 g/mol. Its IUPAC name is (2R)-2-[2-(4-fluorophenyl)ethylamino]-N-(2-methoxydibenzofuran-3-yl)propanamide.
| Compound Name | (2R)-2-[2-(4-fluorophenyl)ethylamino]-N-(2-methoxydibenzofuran-3-yl)propanamide |
|---|---|
| PubChem CID | 2402948 |
| Molecular Formula | C24H23FN2O3 |
| Molecular Weight | 406.46 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (2R)-2-[2-(4-fluorophenyl)ethylamino]-N-(2-methoxydibenzofuran-3-yl)propanamide |
| SMILES | COc1cc2c(cc1NC(=O)[C@@H](C)NCCc1ccc(F)cc1)oc1ccccc12 |
| InChI | InChI=1S/C24H23FN2O3/c1-15(26-12-11-16-7-9-17(25)10-8-16)24(28)27-20-14-22-19(13-23(20)29-2)18-5-3-4-6-21(18)30-22/h3-10,13-15,26H,11-12H2,1-2H3,(H,27,28)/t15-/m1/s1 |
| InChIKey | XMCCCCGCKFLYEM-OAHLLOKOSA-N |
| XLogP | 4.89 |
| TPSA | 63.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.46 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |