C19H15ClN4OS — CID 55842402
6-chloro-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]-1H-indole-2-carboxamide (PubChem CID 55842402) has the molecular formula C19H15ClN4OS and a molecular weight of 382.88 g/mol. Its IUPAC name is 6-chloro-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]-1H-indole-2-carboxamide.
| Compound Name | 6-chloro-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55842402 |
| Molecular Formula | C19H15ClN4OS |
| Molecular Weight | 382.88 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 6-chloro-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]-1H-indole-2-carboxamide |
| SMILES | Cn1ccnc1Sc1ccc(NC(=O)c2cc3ccc(Cl)cc3[nH]2)cc1 |
| InChI | InChI=1S/C19H15ClN4OS/c1-24-9-8-21-19(24)26-15-6-4-14(5-7-15)22-18(25)17-10-12-2-3-13(20)11-16(12)23-17/h2-11,23H,1H3,(H,22,25) |
| InChIKey | XRCRWEMNWKNRKE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |