C14H19ClN4OS — CID 119276286
2-amino-2-methyl-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]propanamide;hydrochloride (PubChem CID 119276286) has the molecular formula C14H19ClN4OS and a molecular weight of 326.85 g/mol. Its IUPAC name is 2-amino-2-methyl-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]propanamide;hydrochloride.
| Compound Name | 2-amino-2-methyl-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119276286 |
| Molecular Formula | C14H19ClN4OS |
| Molecular Weight | 326.85 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | 2-amino-2-methyl-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]propanamide;hydrochloride |
| SMILES | Cl.Cn1ccnc1Sc1ccc(NC(=O)C(C)(C)N)cc1 |
| InChI | InChI=1S/C14H18N4OS.ClH/c1-14(2,15)12(19)17-10-4-6-11(7-5-10)20-13-16-8-9-18(13)3;/h4-9H,15H2,1-3H3,(H,17,19);1H |
| InChIKey | QHDQVWZHGXSBGX-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.85 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |