C15H21ClN4O2S — CID 120587660
4-amino-3-methoxy-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]butanamide;hydrochloride (PubChem CID 120587660) has the molecular formula C15H21ClN4O2S and a molecular weight of 356.88 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]butanamide;hydrochloride.
| Compound Name | 4-amino-3-methoxy-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 120587660 |
| Molecular Formula | C15H21ClN4O2S |
| Molecular Weight | 356.88 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 4-amino-3-methoxy-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]butanamide;hydrochloride |
| SMILES | COC(CN)CC(=O)Nc1ccc(Sc2nccn2C)cc1.Cl |
| InChI | InChI=1S/C15H20N4O2S.ClH/c1-19-8-7-17-15(19)22-13-5-3-11(4-6-13)18-14(20)9-12(10-16)21-2;/h3-8,12H,9-10,16H2,1-2H3,(H,18,20);1H |
| InChIKey | NLGWCRGMUUIVTG-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.88 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |