C16H20N4OS — CID 119699001
2-(cyclopropylmethylamino)-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]acetamide (PubChem CID 119699001) has the molecular formula C16H20N4OS and a molecular weight of 316.43 g/mol. Its IUPAC name is 2-(cyclopropylmethylamino)-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]acetamide.
| Compound Name | 2-(cyclopropylmethylamino)-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 119699001 |
| Molecular Formula | C16H20N4OS |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | 2-(cyclopropylmethylamino)-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]acetamide |
| SMILES | Cn1ccnc1Sc1ccc(NC(=O)CNCC2CC2)cc1 |
| InChI | InChI=1S/C16H20N4OS/c1-20-9-8-18-16(20)22-14-6-4-13(5-7-14)19-15(21)11-17-10-12-2-3-12/h4-9,12,17H,2-3,10-11H2,1H3,(H,19,21) |
| InChIKey | WCPCEFHIVUJHOV-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |