C17H18N6O2S — CID 100723086
N'-(2,5-dimethylpyrazol-3-yl)-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]oxamide (PubChem CID 100723086) has the molecular formula C17H18N6O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is N'-(2,5-dimethylpyrazol-3-yl)-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]oxamide.
| Compound Name | N'-(2,5-dimethylpyrazol-3-yl)-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]oxamide |
|---|---|
| PubChem CID | 100723086 |
| Molecular Formula | C17H18N6O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | N'-(2,5-dimethylpyrazol-3-yl)-N-[4-(1-methylimidazol-2-yl)sulfanylphenyl]oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)Nc2ccc(Sc3nccn3C)cc2)n(C)n1 |
| InChI | InChI=1S/C17H18N6O2S/c1-11-10-14(23(3)21-11)20-16(25)15(24)19-12-4-6-13(7-5-12)26-17-18-8-9-22(17)2/h4-10H,1-3H3,(H,19,24)(H,20,25) |
| InChIKey | LNWGSIPDXIKPJR-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|