C14H18IN3O5S — CID 55842422
N-[[1-(2-iodo-5-nitrobenzoyl)piperidin-3-yl]methyl]methanesulfonamide (PubChem CID 55842422) has the molecular formula C14H18IN3O5S and a molecular weight of 467.29 g/mol. Its IUPAC name is N-[[1-(2-iodo-5-nitrobenzoyl)piperidin-3-yl]methyl]methanesulfonamide.
| Compound Name | N-[[1-(2-iodo-5-nitrobenzoyl)piperidin-3-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 55842422 |
| Molecular Formula | C14H18IN3O5S |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 467.00 |
| IUPAC Name | N-[[1-(2-iodo-5-nitrobenzoyl)piperidin-3-yl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCC1CCCN(C(=O)c2cc([N+](=O)[O-])ccc2I)C1 |
| InChI | InChI=1S/C14H18IN3O5S/c1-24(22,23)16-8-10-3-2-6-17(9-10)14(19)12-7-11(18(20)21)4-5-13(12)15/h4-5,7,10,16H,2-3,6,8-9H2,1H3 |
| InChIKey | SPEXCGPKNDGDJD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|