C11H13N3O2S2 — CID 558425
4-piperidin-1-ylsulfonyl-2,1,3-benzothiadiazole (PubChem CID 558425) has the molecular formula C11H13N3O2S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-piperidin-1-ylsulfonyl-2,1,3-benzothiadiazole.
| Compound Name | 4-piperidin-1-ylsulfonyl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 558425 |
| Molecular Formula | C11H13N3O2S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 4-piperidin-1-ylsulfonyl-2,1,3-benzothiadiazole |
| SMILES | O=S(=O)(c1cccc2nsnc12)N1CCCCC1 |
| InChI | InChI=1S/C11H13N3O2S2/c15-18(16,14-7-2-1-3-8-14)10-6-4-5-9-11(10)13-17-12-9/h4-6H,1-3,7-8H2 |
| InChIKey | NXOMFMSHYBXJTM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |