C10H14N4O3S — CID 2478577
N,N-diethyl-3-hydroxybenzotriazole-5-sulfonamide (PubChem CID 2478577) has the molecular formula C10H14N4O3S and a molecular weight of 270.31 g/mol. Its IUPAC name is N,N-diethyl-3-hydroxybenzotriazole-5-sulfonamide.
| Compound Name | N,N-diethyl-3-hydroxybenzotriazole-5-sulfonamide |
|---|---|
| PubChem CID | 2478577 |
| Molecular Formula | C10H14N4O3S |
| Molecular Weight | 270.31 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | N,N-diethyl-3-hydroxybenzotriazole-5-sulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc2nnn(O)c2c1 |
| InChI | InChI=1S/C10H14N4O3S/c1-3-13(4-2)18(16,17)8-5-6-9-10(7-8)14(15)12-11-9/h5-7,15H,3-4H2,1-2H3 |
| InChIKey | NCQKZZDOZJRYFM-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 88.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.31 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|