C17H18BrN3O3S — CID 55843736
3,5-diacetamido-N-[(4-bromothiophen-2-yl)methyl]-N-methylbenzamide (PubChem CID 55843736) has the molecular formula C17H18BrN3O3S and a molecular weight of 424.32 g/mol. Its IUPAC name is 3,5-diacetamido-N-[(4-bromothiophen-2-yl)methyl]-N-methylbenzamide.
| Compound Name | 3,5-diacetamido-N-[(4-bromothiophen-2-yl)methyl]-N-methylbenzamide |
|---|---|
| PubChem CID | 55843736 |
| Molecular Formula | C17H18BrN3O3S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | 3,5-diacetamido-N-[(4-bromothiophen-2-yl)methyl]-N-methylbenzamide |
| SMILES | CC(=O)Nc1cc(NC(C)=O)cc(C(=O)N(C)Cc2cc(Br)cs2)c1 |
| InChI | InChI=1S/C17H18BrN3O3S/c1-10(22)19-14-4-12(5-15(7-14)20-11(2)23)17(24)21(3)8-16-6-13(18)9-25-16/h4-7,9H,8H2,1-3H3,(H,19,22)(H,20,23) |
| InChIKey | REAHSLCSAIAICA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |