C21H30N4O3 — CID 55844686
benzyl N-[4-[[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]amino]-4-oxobutyl]carbamate (PubChem CID 55844686) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is benzyl N-[4-[[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]amino]-4-oxobutyl]carbamate.
| Compound Name | benzyl N-[4-[[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]amino]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 55844686 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | benzyl N-[4-[[3-(3,5-dimethylpyrazol-1-yl)-2-methylpropyl]amino]-4-oxobutyl]carbamate |
| SMILES | Cc1cc(C)n(CC(C)CNC(=O)CCCNC(=O)OCc2ccccc2)n1 |
| InChI | InChI=1S/C21H30N4O3/c1-16(14-25-18(3)12-17(2)24-25)13-23-20(26)10-7-11-22-21(27)28-15-19-8-5-4-6-9-19/h4-6,8-9,12,16H,7,10-11,13-15H2,1-3H3,(H,22,27)(H,23,26) |
| InChIKey | XHEWMQFZEYADAY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 85.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|