C18H23ClN4O5S — CID 55846108
2-[4-[3-[(2-chlorophenyl)sulfonylamino]propanoyl]piperazin-1-yl]-N-cyclopropyl-2-oxoacetamide (PubChem CID 55846108) has the molecular formula C18H23ClN4O5S and a molecular weight of 442.93 g/mol. Its IUPAC name is 2-[4-[3-[(2-chlorophenyl)sulfonylamino]propanoyl]piperazin-1-yl]-N-cyclopropyl-2-oxoacetamide.
| Compound Name | 2-[4-[3-[(2-chlorophenyl)sulfonylamino]propanoyl]piperazin-1-yl]-N-cyclopropyl-2-oxoacetamide |
|---|---|
| PubChem CID | 55846108 |
| Molecular Formula | C18H23ClN4O5S |
| Molecular Weight | 442.93 g/mol |
| Exact Mass | 442.11 |
| IUPAC Name | 2-[4-[3-[(2-chlorophenyl)sulfonylamino]propanoyl]piperazin-1-yl]-N-cyclopropyl-2-oxoacetamide |
| SMILES | O=C(NC1CC1)C(=O)N1CCN(C(=O)CCNS(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C18H23ClN4O5S/c19-14-3-1-2-4-15(14)29(27,28)20-8-7-16(24)22-9-11-23(12-10-22)18(26)17(25)21-13-5-6-13/h1-4,13,20H,5-12H2,(H,21,25) |
| InChIKey | VHYWOKNXRGIKNB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.93 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|