C19H29ClN4O4S — CID 55884585
N-butan-2-yl-2-[4-[3-[(2-chlorophenyl)sulfonylamino]propanoyl]piperazin-1-yl]acetamide (PubChem CID 55884585) has the molecular formula C19H29ClN4O4S and a molecular weight of 444.99 g/mol. Its IUPAC name is N-butan-2-yl-2-[4-[3-[(2-chlorophenyl)sulfonylamino]propanoyl]piperazin-1-yl]acetamide.
| Compound Name | N-butan-2-yl-2-[4-[3-[(2-chlorophenyl)sulfonylamino]propanoyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 55884585 |
| Molecular Formula | C19H29ClN4O4S |
| Molecular Weight | 444.99 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-butan-2-yl-2-[4-[3-[(2-chlorophenyl)sulfonylamino]propanoyl]piperazin-1-yl]acetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(C(=O)CCNS(=O)(=O)c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C19H29ClN4O4S/c1-3-15(2)22-18(25)14-23-10-12-24(13-11-23)19(26)8-9-21-29(27,28)17-7-5-4-6-16(17)20/h4-7,15,21H,3,8-14H2,1-2H3,(H,22,25) |
| InChIKey | FFGWQOQSNNENBE-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.99 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |