C9H16O — CID 558471
6-methoxy-3,3-dimethylcyclohexene (PubChem CID 558471) has the molecular formula C9H16O and a molecular weight of 140.23 g/mol. Its IUPAC name is 6-methoxy-3,3-dimethylcyclohexene.
| Compound Name | 6-methoxy-3,3-dimethylcyclohexene |
|---|---|
| PubChem CID | 558471 |
| Molecular Formula | C9H16O |
| Molecular Weight | 140.23 g/mol |
| Exact Mass | 140.12 |
| IUPAC Name | 6-methoxy-3,3-dimethylcyclohexene |
| SMILES | COC1C=CC(C)(C)CC1 |
| InChI | InChI=1S/C9H16O/c1-9(2)6-4-8(10-3)5-7-9/h4,6,8H,5,7H2,1-3H3 |
| InChIKey | CVFQOTYDJSZQMQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.23 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|