C21H27N5O2 — CID 55847521
4-(cyclopropylcarbamoylamino)-N-[[6-(diethylamino)-3-pyridinyl]methyl]benzamide (PubChem CID 55847521) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(cyclopropylcarbamoylamino)-N-[[6-(diethylamino)-3-pyridinyl]methyl]benzamide.
| Compound Name | 4-(cyclopropylcarbamoylamino)-N-[[6-(diethylamino)-3-pyridinyl]methyl]benzamide |
|---|---|
| PubChem CID | 55847521 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-(cyclopropylcarbamoylamino)-N-[[6-(diethylamino)-3-pyridinyl]methyl]benzamide |
| SMILES | CCN(CC)c1ccc(CNC(=O)c2ccc(NC(=O)NC3CC3)cc2)cn1 |
| InChI | InChI=1S/C21H27N5O2/c1-3-26(4-2)19-12-5-15(13-22-19)14-23-20(27)16-6-8-17(9-7-16)24-21(28)25-18-10-11-18/h5-9,12-13,18H,3-4,10-11,14H2,1-2H3,(H,23,27)(H2,24,25,28) |
| InChIKey | IUIGOMGFUKUXCQ-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |