C21H19FN2O4 — CID 55847820
3-[[[2-(2-fluorophenoxy)acetyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide (PubChem CID 55847820) has the molecular formula C21H19FN2O4 and a molecular weight of 382.39 g/mol. Its IUPAC name is 3-[[[2-(2-fluorophenoxy)acetyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide.
| Compound Name | 3-[[[2-(2-fluorophenoxy)acetyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 55847820 |
| Molecular Formula | C21H19FN2O4 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | 3-[[[2-(2-fluorophenoxy)acetyl]amino]methyl]-N-(furan-2-ylmethyl)benzamide |
| SMILES | O=C(COc1ccccc1F)NCc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C21H19FN2O4/c22-18-8-1-2-9-19(18)28-14-20(25)23-12-15-5-3-6-16(11-15)21(26)24-13-17-7-4-10-27-17/h1-11H,12-14H2,(H,23,25)(H,24,26) |
| InChIKey | TUUGHXRXBYTOTB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |