C22H25N3O5S2 — CID 55847875
2-[2-(2-methoxyphenoxy)ethylsulfanyl]-5-(3-piperidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole (PubChem CID 55847875) has the molecular formula C22H25N3O5S2 and a molecular weight of 475.59 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenoxy)ethylsulfanyl]-5-(3-piperidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(2-methoxyphenoxy)ethylsulfanyl]-5-(3-piperidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 55847875 |
| Molecular Formula | C22H25N3O5S2 |
| Molecular Weight | 475.59 g/mol |
| Exact Mass | 475.12 |
| IUPAC Name | 2-[2-(2-methoxyphenoxy)ethylsulfanyl]-5-(3-piperidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole |
| SMILES | COc1ccccc1OCCSc1nnc(-c2cccc(S(=O)(=O)N3CCCCC3)c2)o1 |
| InChI | InChI=1S/C22H25N3O5S2/c1-28-19-10-3-4-11-20(19)29-14-15-31-22-24-23-21(30-22)17-8-7-9-18(16-17)32(26,27)25-12-5-2-6-13-25/h3-4,7-11,16H,2,5-6,12-15H2,1H3 |
| InChIKey | SBSLWBYDVROQBY-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 94.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.59 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|