C17H23N3O4S2 — CID 9406828
2-(2-ethoxyethylsulfanyl)-5-(3-piperidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole (PubChem CID 9406828) has the molecular formula C17H23N3O4S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 2-(2-ethoxyethylsulfanyl)-5-(3-piperidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-(2-ethoxyethylsulfanyl)-5-(3-piperidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 9406828 |
| Molecular Formula | C17H23N3O4S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 2-(2-ethoxyethylsulfanyl)-5-(3-piperidin-1-ylsulfonylphenyl)-1,3,4-oxadiazole |
| SMILES | CCOCCSc1nnc(-c2cccc(S(=O)(=O)N3CCCCC3)c2)o1 |
| InChI | InChI=1S/C17H23N3O4S2/c1-2-23-11-12-25-17-19-18-16(24-17)14-7-6-8-15(13-14)26(21,22)20-9-4-3-5-10-20/h6-8,13H,2-5,9-12H2,1H3 |
| InChIKey | BQQJDCFYQRKUPG-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 85.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|