C19H22N8O3 — CID 55848451
2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1-[4-(3-nitrophenyl)piperazin-1-yl]ethanone (PubChem CID 55848451) has the molecular formula C19H22N8O3 and a molecular weight of 410.44 g/mol. Its IUPAC name is 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1-[4-(3-nitrophenyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1-[4-(3-nitrophenyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 55848451 |
| Molecular Formula | C19H22N8O3 |
| Molecular Weight | 410.44 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1-[4-(3-nitrophenyl)piperazin-1-yl]ethanone |
| SMILES | Cc1nc2nc(N)nn2c(C)c1CC(=O)N1CCN(c2cccc([N+](=O)[O-])c2)CC1 |
| InChI | InChI=1S/C19H22N8O3/c1-12-16(13(2)26-19(21-12)22-18(20)23-26)11-17(28)25-8-6-24(7-9-25)14-4-3-5-15(10-14)27(29)30/h3-5,10H,6-9,11H2,1-2H3,(H2,20,23) |
| InChIKey | SJYGHLYTZGKYRR-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|