C19H21F2N7O3S — CID 38078973
2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 38078973) has the molecular formula C19H21F2N7O3S and a molecular weight of 465.49 g/mol. Its IUPAC name is 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 38078973 |
| Molecular Formula | C19H21F2N7O3S |
| Molecular Weight | 465.49 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | 2-(2-amino-5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-6-yl)-1-[4-(3,4-difluorophenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | Cc1nc2nc(N)nn2c(C)c1CC(=O)N1CCN(S(=O)(=O)c2ccc(F)c(F)c2)CC1 |
| InChI | InChI=1S/C19H21F2N7O3S/c1-11-14(12(2)28-19(23-11)24-18(22)25-28)10-17(29)26-5-7-27(8-6-26)32(30,31)13-3-4-15(20)16(21)9-13/h3-4,9H,5-8,10H2,1-2H3,(H2,22,25) |
| InChIKey | SNYCTINIAXPVIX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 126.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.49 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |