C22H32N6O — CID 55849136
3-(3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-N-[4-(3-methylpiperidin-1-yl)butyl]propanamide (PubChem CID 55849136) has the molecular formula C22H32N6O and a molecular weight of 396.54 g/mol. Its IUPAC name is 3-(3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-N-[4-(3-methylpiperidin-1-yl)butyl]propanamide.
| Compound Name | 3-(3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-N-[4-(3-methylpiperidin-1-yl)butyl]propanamide |
|---|---|
| PubChem CID | 55849136 |
| Molecular Formula | C22H32N6O |
| Molecular Weight | 396.54 g/mol |
| Exact Mass | 396.26 |
| IUPAC Name | 3-(3-cyano-5,7-dimethylpyrazolo[1,5-a]pyrimidin-6-yl)-N-[4-(3-methylpiperidin-1-yl)butyl]propanamide |
| SMILES | Cc1nc2c(C#N)cnn2c(C)c1CCC(=O)NCCCCN1CCCC(C)C1 |
| InChI | InChI=1S/C22H32N6O/c1-16-7-6-12-27(15-16)11-5-4-10-24-21(29)9-8-20-17(2)26-22-19(13-23)14-25-28(22)18(20)3/h14,16H,4-12,15H2,1-3H3,(H,24,29) |
| InChIKey | RAWBNJBCJPDTCY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 86.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.54 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|