C20H18FN3O2S — CID 55851836
N-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(propanoylamino)benzamide (PubChem CID 55851836) has the molecular formula C20H18FN3O2S and a molecular weight of 383.45 g/mol. Its IUPAC name is N-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(propanoylamino)benzamide.
| Compound Name | N-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(propanoylamino)benzamide |
|---|---|
| PubChem CID | 55851836 |
| Molecular Formula | C20H18FN3O2S |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.11 |
| IUPAC Name | N-[5-[(3-fluorophenyl)methyl]-1,3-thiazol-2-yl]-3-(propanoylamino)benzamide |
| SMILES | CCC(=O)Nc1cccc(C(=O)Nc2ncc(Cc3cccc(F)c3)s2)c1 |
| InChI | InChI=1S/C20H18FN3O2S/c1-2-18(25)23-16-8-4-6-14(11-16)19(26)24-20-22-12-17(27-20)10-13-5-3-7-15(21)9-13/h3-9,11-12H,2,10H2,1H3,(H,23,25)(H,22,24,26) |
| InChIKey | ZLZLJVLNYONCSY-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |