C19H26ClN3O4 — CID 55854581
[1-(5-chloro-6-propan-2-yloxypyridine-3-carbonyl)piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 55854581) has the molecular formula C19H26ClN3O4 and a molecular weight of 395.89 g/mol. Its IUPAC name is [1-(5-chloro-6-propan-2-yloxypyridine-3-carbonyl)piperidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(5-chloro-6-propan-2-yloxypyridine-3-carbonyl)piperidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 55854581 |
| Molecular Formula | C19H26ClN3O4 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | [1-(5-chloro-6-propan-2-yloxypyridine-3-carbonyl)piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | CC(C)Oc1ncc(C(=O)N2CCC(C(=O)N3CCOCC3)CC2)cc1Cl |
| InChI | InChI=1S/C19H26ClN3O4/c1-13(2)27-17-16(20)11-15(12-21-17)19(25)22-5-3-14(4-6-22)18(24)23-7-9-26-10-8-23/h11-14H,3-10H2,1-2H3 |
| InChIKey | ZYTUBUNVZQYBQW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |