C19H20Cl2N2O3 — CID 55947772
[2-(4-chlorophenyl)morpholin-4-yl]-(5-chloro-6-propan-2-yloxy-3-pyridinyl)methanone (PubChem CID 55947772) has the molecular formula C19H20Cl2N2O3 and a molecular weight of 395.29 g/mol. Its IUPAC name is [2-(4-chlorophenyl)morpholin-4-yl]-(5-chloro-6-propan-2-yloxy-3-pyridinyl)methanone.
| Compound Name | [2-(4-chlorophenyl)morpholin-4-yl]-(5-chloro-6-propan-2-yloxy-3-pyridinyl)methanone |
|---|---|
| PubChem CID | 55947772 |
| Molecular Formula | C19H20Cl2N2O3 |
| Molecular Weight | 395.29 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | [2-(4-chlorophenyl)morpholin-4-yl]-(5-chloro-6-propan-2-yloxy-3-pyridinyl)methanone |
| SMILES | CC(C)Oc1ncc(C(=O)N2CCOC(c3ccc(Cl)cc3)C2)cc1Cl |
| InChI | InChI=1S/C19H20Cl2N2O3/c1-12(2)26-18-16(21)9-14(10-22-18)19(24)23-7-8-25-17(11-23)13-3-5-15(20)6-4-13/h3-6,9-10,12,17H,7-8,11H2,1-2H3 |
| InChIKey | CGAQIIMAUDRCIP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |