C24H26F3N3O2S — CID 55855211
5-oxo-N-[(4-thiomorpholin-4-ylphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide (PubChem CID 55855211) has the molecular formula C24H26F3N3O2S and a molecular weight of 477.55 g/mol. Its IUPAC name is 5-oxo-N-[(4-thiomorpholin-4-ylphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide.
| Compound Name | 5-oxo-N-[(4-thiomorpholin-4-ylphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55855211 |
| Molecular Formula | C24H26F3N3O2S |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.17 |
| IUPAC Name | 5-oxo-N-[(4-thiomorpholin-4-ylphenyl)methyl]-1-[[3-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCSCC2)cc1)C1CC(=O)N(Cc2cccc(C(F)(F)F)c2)C1 |
| InChI | InChI=1S/C24H26F3N3O2S/c25-24(26,27)20-3-1-2-18(12-20)15-30-16-19(13-22(30)31)23(32)28-14-17-4-6-21(7-5-17)29-8-10-33-11-9-29/h1-7,12,19H,8-11,13-16H2,(H,28,32) |
| InChIKey | SWRUQSGLLOHAFW-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|