C21H20ClN5O5 — CID 55855976
[1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethyl] 2-morpholin-4-yl-5-nitrobenzoate (PubChem CID 55855976) has the molecular formula C21H20ClN5O5 and a molecular weight of 457.87 g/mol. Its IUPAC name is [1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethyl] 2-morpholin-4-yl-5-nitrobenzoate.
| Compound Name | [1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethyl] 2-morpholin-4-yl-5-nitrobenzoate |
|---|---|
| PubChem CID | 55855976 |
| Molecular Formula | C21H20ClN5O5 |
| Molecular Weight | 457.87 g/mol |
| Exact Mass | 457.12 |
| IUPAC Name | [1-(4-chlorophenyl)-2-(1,2,4-triazol-1-yl)ethyl] 2-morpholin-4-yl-5-nitrobenzoate |
| SMILES | O=C(OC(Cn1cncn1)c1ccc(Cl)cc1)c1cc([N+](=O)[O-])ccc1N1CCOCC1 |
| InChI | InChI=1S/C21H20ClN5O5/c22-16-3-1-15(2-4-16)20(12-26-14-23-13-24-26)32-21(28)18-11-17(27(29)30)5-6-19(18)25-7-9-31-10-8-25/h1-6,11,13-14,20H,7-10,12H2 |
| InChIKey | MPPNGIUDAFIYLJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.87 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|