C24H29FN2O3 — CID 55856025
N-ethyl-N-[(3-fluorophenyl)methyl]-1-(3-phenoxypropanoyl)piperidine-4-carboxamide (PubChem CID 55856025) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is N-ethyl-N-[(3-fluorophenyl)methyl]-1-(3-phenoxypropanoyl)piperidine-4-carboxamide.
| Compound Name | N-ethyl-N-[(3-fluorophenyl)methyl]-1-(3-phenoxypropanoyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55856025 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | N-ethyl-N-[(3-fluorophenyl)methyl]-1-(3-phenoxypropanoyl)piperidine-4-carboxamide |
| SMILES | CCN(Cc1cccc(F)c1)C(=O)C1CCN(C(=O)CCOc2ccccc2)CC1 |
| InChI | InChI=1S/C24H29FN2O3/c1-2-26(18-19-7-6-8-21(25)17-19)24(29)20-11-14-27(15-12-20)23(28)13-16-30-22-9-4-3-5-10-22/h3-10,17,20H,2,11-16,18H2,1H3 |
| InChIKey | XXQNXKZAKOZEBN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |