C18H20F2N2O3S — CID 55861005
N-[1-(2,6-difluorophenyl)propan-2-yl]-4-(ethylsulfamoyl)benzamide (PubChem CID 55861005) has the molecular formula C18H20F2N2O3S and a molecular weight of 382.43 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)propan-2-yl]-4-(ethylsulfamoyl)benzamide.
| Compound Name | N-[1-(2,6-difluorophenyl)propan-2-yl]-4-(ethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55861005 |
| Molecular Formula | C18H20F2N2O3S |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)propan-2-yl]-4-(ethylsulfamoyl)benzamide |
| SMILES | CCNS(=O)(=O)c1ccc(C(=O)NC(C)Cc2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C18H20F2N2O3S/c1-3-21-26(24,25)14-9-7-13(8-10-14)18(23)22-12(2)11-15-16(19)5-4-6-17(15)20/h4-10,12,21H,3,11H2,1-2H3,(H,22,23) |
| InChIKey | PXBNZADWBLUTCC-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |