C18H16F3N7O3 — CID 55861063
1,3-bis(prop-2-enyl)-5-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 55861063) has the molecular formula C18H16F3N7O3 and a molecular weight of 435.37 g/mol. Its IUPAC name is 1,3-bis(prop-2-enyl)-5-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis(prop-2-enyl)-5-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 55861063 |
| Molecular Formula | C18H16F3N7O3 |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 435.13 |
| IUPAC Name | 1,3-bis(prop-2-enyl)-5-[[1-[4-(trifluoromethyl)phenyl]tetrazol-5-yl]methyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | C=CCn1c(=O)n(CC=C)c(=O)n(Cc2nnnn2-c2ccc(C(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C18H16F3N7O3/c1-3-9-25-15(29)26(10-4-2)17(31)27(16(25)30)11-14-22-23-24-28(14)13-7-5-12(6-8-13)18(19,20)21/h3-8H,1-2,9-11H2 |
| InChIKey | LOYFSVWLSUKTQE-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 109.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|