C17H23F3N6 — CID 1443786
1-[(1-tert-butyltetrazol-5-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine (PubChem CID 1443786) has the molecular formula C17H23F3N6 and a molecular weight of 368.41 g/mol. Its IUPAC name is 1-[(1-tert-butyltetrazol-5-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine.
| Compound Name | 1-[(1-tert-butyltetrazol-5-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
|---|---|
| PubChem CID | 1443786 |
| Molecular Formula | C17H23F3N6 |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | 1-[(1-tert-butyltetrazol-5-yl)methyl]-4-[3-(trifluoromethyl)phenyl]piperazine |
| SMILES | CC(C)(C)n1nnnc1CN1CCN(c2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C17H23F3N6/c1-16(2,3)26-15(21-22-23-26)12-24-7-9-25(10-8-24)14-6-4-5-13(11-14)17(18,19)20/h4-6,11H,7-10,12H2,1-3H3 |
| InChIKey | GBRPORDYIVGGAJ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |