C20H30ClFN6 — CID 6603068
1-[1-(1-cyclopentyltetrazol-5-yl)butyl]-4-(2-fluorophenyl)piperazine;hydrochloride (PubChem CID 6603068) has the molecular formula C20H30ClFN6 and a molecular weight of 408.95 g/mol. Its IUPAC name is 1-[1-(1-cyclopentyltetrazol-5-yl)butyl]-4-(2-fluorophenyl)piperazine;hydrochloride.
| Compound Name | 1-[1-(1-cyclopentyltetrazol-5-yl)butyl]-4-(2-fluorophenyl)piperazine;hydrochloride |
|---|---|
| PubChem CID | 6603068 |
| Molecular Formula | C20H30ClFN6 |
| Molecular Weight | 408.95 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-[1-(1-cyclopentyltetrazol-5-yl)butyl]-4-(2-fluorophenyl)piperazine;hydrochloride |
| SMILES | CCCC(c1nnnn1C1CCCC1)N1CCN(c2ccccc2F)CC1.Cl |
| InChI | InChI=1S/C20H29FN6.ClH/c1-2-7-19(20-22-23-24-27(20)16-8-3-4-9-16)26-14-12-25(13-15-26)18-11-6-5-10-17(18)21;/h5-6,10-11,16,19H,2-4,7-9,12-15H2,1H3;1H |
| InChIKey | FHAHVQFWDFBRQI-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 50.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.95 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |