C25H33FN2O2 — CID 55861856
N-[2-(2-fluorophenyl)ethyl]-1-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 55861856) has the molecular formula C25H33FN2O2 and a molecular weight of 412.55 g/mol. Its IUPAC name is N-[2-(2-fluorophenyl)ethyl]-1-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | N-[2-(2-fluorophenyl)ethyl]-1-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55861856 |
| Molecular Formula | C25H33FN2O2 |
| Molecular Weight | 412.55 g/mol |
| Exact Mass | 412.25 |
| IUPAC Name | N-[2-(2-fluorophenyl)ethyl]-1-[(2-hydroxy-4-methyl-5-propan-2-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1cc(O)c(CN2CCC(C(=O)NCCc3ccccc3F)CC2)cc1C(C)C |
| InChI | InChI=1S/C25H33FN2O2/c1-17(2)22-15-21(24(29)14-18(22)3)16-28-12-9-20(10-13-28)25(30)27-11-8-19-6-4-5-7-23(19)26/h4-7,14-15,17,20,29H,8-13,16H2,1-3H3,(H,27,30) |
| InChIKey | ODKPHTGCUABYSQ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|