C24H38N2O3 — CID 55862941
N-butyl-1-[2-(3-tert-butylphenoxy)propanoyl]-N-methylpiperidine-4-carboxamide (PubChem CID 55862941) has the molecular formula C24H38N2O3 and a molecular weight of 402.58 g/mol. Its IUPAC name is N-butyl-1-[2-(3-tert-butylphenoxy)propanoyl]-N-methylpiperidine-4-carboxamide.
| Compound Name | N-butyl-1-[2-(3-tert-butylphenoxy)propanoyl]-N-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55862941 |
| Molecular Formula | C24H38N2O3 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.29 |
| IUPAC Name | N-butyl-1-[2-(3-tert-butylphenoxy)propanoyl]-N-methylpiperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(C(=O)C(C)Oc2cccc(C(C)(C)C)c2)CC1 |
| InChI | InChI=1S/C24H38N2O3/c1-7-8-14-25(6)23(28)19-12-15-26(16-13-19)22(27)18(2)29-21-11-9-10-20(17-21)24(3,4)5/h9-11,17-19H,7-8,12-16H2,1-6H3 |
| InChIKey | PXLHQNKGSUGFLY-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |