C24H20N6O2 — CID 55862999
N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-pyridin-3-ylquinoline-4-carboxamide (PubChem CID 55862999) has the molecular formula C24H20N6O2 and a molecular weight of 424.46 g/mol. Its IUPAC name is N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-pyridin-3-ylquinoline-4-carboxamide.
| Compound Name | N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-pyridin-3-ylquinoline-4-carboxamide |
|---|---|
| PubChem CID | 55862999 |
| Molecular Formula | C24H20N6O2 |
| Molecular Weight | 424.46 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | N-[3-(3-oxo-[1,2,4]triazolo[4,3-a]pyridin-2-yl)propyl]-2-pyridin-3-ylquinoline-4-carboxamide |
| SMILES | O=C(NCCCn1nc2ccccn2c1=O)c1cc(-c2cccnc2)nc2ccccc12 |
| InChI | InChI=1S/C24H20N6O2/c31-23(26-12-6-14-30-24(32)29-13-4-3-10-22(29)28-30)19-15-21(17-7-5-11-25-16-17)27-20-9-2-1-8-18(19)20/h1-5,7-11,13,15-16H,6,12,14H2,(H,26,31) |
| InChIKey | BTBZSWLPFUEAER-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 94.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.46 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|