C24H29N3O3S — CID 55864228
N-benzyl-N-(cyanomethyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide (PubChem CID 55864228) has the molecular formula C24H29N3O3S and a molecular weight of 439.58 g/mol. Its IUPAC name is N-benzyl-N-(cyanomethyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide.
| Compound Name | N-benzyl-N-(cyanomethyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 55864228 |
| Molecular Formula | C24H29N3O3S |
| Molecular Weight | 439.58 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | N-benzyl-N-(cyanomethyl)-1-(2,4,6-trimethylphenyl)sulfonylpiperidine-4-carboxamide |
| SMILES | Cc1cc(C)c(S(=O)(=O)N2CCC(C(=O)N(CC#N)Cc3ccccc3)CC2)c(C)c1 |
| InChI | InChI=1S/C24H29N3O3S/c1-18-15-19(2)23(20(3)16-18)31(29,30)27-12-9-22(10-13-27)24(28)26(14-11-25)17-21-7-5-4-6-8-21/h4-8,15-16,22H,9-10,12-14,17H2,1-3H3 |
| InChIKey | LWPKDXADBXWAJC-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 81.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.58 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|