C24H29N5O — CID 55864610
N-benzyl-1-tert-butyl-N-(cyanomethyl)-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55864610) has the molecular formula C24H29N5O and a molecular weight of 403.53 g/mol. Its IUPAC name is N-benzyl-1-tert-butyl-N-(cyanomethyl)-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-benzyl-1-tert-butyl-N-(cyanomethyl)-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55864610 |
| Molecular Formula | C24H29N5O |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.24 |
| IUPAC Name | N-benzyl-1-tert-butyl-N-(cyanomethyl)-3-methyl-6-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1nn(C(C)(C)C)c2nc(C(C)C)cc(C(=O)N(CC#N)Cc3ccccc3)c12 |
| InChI | InChI=1S/C24H29N5O/c1-16(2)20-14-19(21-17(3)27-29(22(21)26-20)24(4,5)6)23(30)28(13-12-25)15-18-10-8-7-9-11-18/h7-11,14,16H,13,15H2,1-6H3 |
| InChIKey | KOWUHWHIWCDNMC-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 74.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|