C20H22N4O2S — CID 55865734
N-(5-methyl-2-pyridinyl)-1-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperidine-4-carboxamide (PubChem CID 55865734) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-(5-methyl-2-pyridinyl)-1-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperidine-4-carboxamide.
| Compound Name | N-(5-methyl-2-pyridinyl)-1-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55865734 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-(5-methyl-2-pyridinyl)-1-[(2-sulfanylidene-1,3-benzoxazol-3-yl)methyl]piperidine-4-carboxamide |
| SMILES | Cc1ccc(NC(=O)C2CCN(Cn3c(=S)oc4ccccc43)CC2)nc1 |
| InChI | InChI=1S/C20H22N4O2S/c1-14-6-7-18(21-12-14)22-19(25)15-8-10-23(11-9-15)13-24-16-4-2-3-5-17(16)26-20(24)27/h2-7,12,15H,8-11,13H2,1H3,(H,21,22,25) |
| InChIKey | VKEWDIULCAZNRV-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 63.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|