C24H35N5O3 — CID 55866016
tert-butyl 4-[3-[(5-ethyl-1-phenylpyrazole-4-carbonyl)amino]propyl]piperazine-1-carboxylate (PubChem CID 55866016) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is tert-butyl 4-[3-[(5-ethyl-1-phenylpyrazole-4-carbonyl)amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[(5-ethyl-1-phenylpyrazole-4-carbonyl)amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55866016 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | tert-butyl 4-[3-[(5-ethyl-1-phenylpyrazole-4-carbonyl)amino]propyl]piperazine-1-carboxylate |
| SMILES | CCc1c(C(=O)NCCCN2CCN(C(=O)OC(C)(C)C)CC2)cnn1-c1ccccc1 |
| InChI | InChI=1S/C24H35N5O3/c1-5-21-20(18-26-29(21)19-10-7-6-8-11-19)22(30)25-12-9-13-27-14-16-28(17-15-27)23(31)32-24(2,3)4/h6-8,10-11,18H,5,9,12-17H2,1-4H3,(H,25,30) |
| InChIKey | SGHSGIWOPRAGKJ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|