C25H36FN5O3 — CID 60518063
tert-butyl 4-[3-[[1-(4-fluorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 60518063) has the molecular formula C25H36FN5O3 and a molecular weight of 473.59 g/mol. Its IUPAC name is tert-butyl 4-[3-[[1-(4-fluorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[1-(4-fluorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 60518063 |
| Molecular Formula | C25H36FN5O3 |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.28 |
| IUPAC Name | tert-butyl 4-[3-[[1-(4-fluorophenyl)-5-propan-2-ylpyrazole-4-carbonyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)c1c(C(=O)NCCCN2CCN(C(=O)OC(C)(C)C)CC2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C25H36FN5O3/c1-18(2)22-21(17-28-31(22)20-9-7-19(26)8-10-20)23(32)27-11-6-12-29-13-15-30(16-14-29)24(33)34-25(3,4)5/h7-10,17-18H,6,11-16H2,1-5H3,(H,27,32) |
| InChIKey | WPGJRHCVBROUAJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 79.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|