C22H33FN4O4 — CID 55867962
tert-butyl 4-[3-[[2-[[2-(3-fluorophenyl)acetyl]amino]acetyl]amino]propyl]piperazine-1-carboxylate (PubChem CID 55867962) has the molecular formula C22H33FN4O4 and a molecular weight of 436.53 g/mol. Its IUPAC name is tert-butyl 4-[3-[[2-[[2-(3-fluorophenyl)acetyl]amino]acetyl]amino]propyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[[2-[[2-(3-fluorophenyl)acetyl]amino]acetyl]amino]propyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 55867962 |
| Molecular Formula | C22H33FN4O4 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.25 |
| IUPAC Name | tert-butyl 4-[3-[[2-[[2-(3-fluorophenyl)acetyl]amino]acetyl]amino]propyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCCNC(=O)CNC(=O)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C22H33FN4O4/c1-22(2,3)31-21(30)27-12-10-26(11-13-27)9-5-8-24-20(29)16-25-19(28)15-17-6-4-7-18(23)14-17/h4,6-7,14H,5,8-13,15-16H2,1-3H3,(H,24,29)(H,25,28) |
| InChIKey | VRFSYFBVBVDGFT-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|