C20H22BrN5O3 — CID 55867230
1-[4-[3-(4-bromophenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione (PubChem CID 55867230) has the molecular formula C20H22BrN5O3 and a molecular weight of 460.33 g/mol. Its IUPAC name is 1-[4-[3-(4-bromophenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione.
| Compound Name | 1-[4-[3-(4-bromophenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
|---|---|
| PubChem CID | 55867230 |
| Molecular Formula | C20H22BrN5O3 |
| Molecular Weight | 460.33 g/mol |
| Exact Mass | 459.09 |
| IUPAC Name | 1-[4-[3-(4-bromophenyl)-1H-pyrazole-5-carbonyl]piperazin-1-yl]-2-pyrrolidin-1-ylethane-1,2-dione |
| SMILES | O=C(C(=O)N1CCN(C(=O)c2cc(-c3ccc(Br)cc3)n[nH]2)CC1)N1CCCC1 |
| InChI | InChI=1S/C20H22BrN5O3/c21-15-5-3-14(4-6-15)16-13-17(23-22-16)18(27)25-9-11-26(12-10-25)20(29)19(28)24-7-1-2-8-24/h3-6,13H,1-2,7-12H2,(H,22,23) |
| InChIKey | YPYJMECQFBAARV-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.33 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|