C20H23BrN4O3 — CID 39557320
[1-[3-(4-bromophenyl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]-morpholin-4-ylmethanone (PubChem CID 39557320) has the molecular formula C20H23BrN4O3 and a molecular weight of 447.33 g/mol. Its IUPAC name is [1-[3-(4-bromophenyl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[3-(4-bromophenyl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 39557320 |
| Molecular Formula | C20H23BrN4O3 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.10 |
| IUPAC Name | [1-[3-(4-bromophenyl)-1H-pyrazole-5-carbonyl]piperidin-4-yl]-morpholin-4-ylmethanone |
| SMILES | O=C(c1cc(-c2ccc(Br)cc2)n[nH]1)N1CCC(C(=O)N2CCOCC2)CC1 |
| InChI | InChI=1S/C20H23BrN4O3/c21-16-3-1-14(2-4-16)17-13-18(23-22-17)20(27)24-7-5-15(6-8-24)19(26)25-9-11-28-12-10-25/h1-4,13,15H,5-12H2,(H,22,23) |
| InChIKey | YNMZFTCKDFXKJP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 78.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |