C16H18BrN3O3 — CID 91653266
[3-(4-bromophenyl)-1H-pyrazol-5-yl]-[3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methanone (PubChem CID 91653266) has the molecular formula C16H18BrN3O3 and a molecular weight of 380.24 g/mol. Its IUPAC name is [3-(4-bromophenyl)-1H-pyrazol-5-yl]-[3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methanone.
| Compound Name | [3-(4-bromophenyl)-1H-pyrazol-5-yl]-[3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 91653266 |
| Molecular Formula | C16H18BrN3O3 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 379.05 |
| IUPAC Name | [3-(4-bromophenyl)-1H-pyrazol-5-yl]-[3-hydroxy-4-(hydroxymethyl)piperidin-1-yl]methanone |
| SMILES | O=C(c1cc(-c2ccc(Br)cc2)n[nH]1)N1CCC(CO)C(O)C1 |
| InChI | InChI=1S/C16H18BrN3O3/c17-12-3-1-10(2-4-12)13-7-14(19-18-13)16(23)20-6-5-11(9-21)15(22)8-20/h1-4,7,11,15,21-22H,5-6,8-9H2,(H,18,19) |
| InChIKey | JCMDMGNFDKSDMH-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 89.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |