C21H24ClN3O4S — CID 55868135
2-chloro-N-[1-oxo-1-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]propan-2-yl]benzamide (PubChem CID 55868135) has the molecular formula C21H24ClN3O4S and a molecular weight of 449.96 g/mol. Its IUPAC name is 2-chloro-N-[1-oxo-1-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]propan-2-yl]benzamide.
| Compound Name | 2-chloro-N-[1-oxo-1-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]propan-2-yl]benzamide |
|---|---|
| PubChem CID | 55868135 |
| Molecular Formula | C21H24ClN3O4S |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 2-chloro-N-[1-oxo-1-[(4-pyrrolidin-1-ylsulfonylphenyl)methylamino]propan-2-yl]benzamide |
| SMILES | CC(NC(=O)c1ccccc1Cl)C(=O)NCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H24ClN3O4S/c1-15(24-21(27)18-6-2-3-7-19(18)22)20(26)23-14-16-8-10-17(11-9-16)30(28,29)25-12-4-5-13-25/h2-3,6-11,15H,4-5,12-14H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | RAQMRJVDIYYHKR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |