C17H22N4O2S2 — CID 55868813
3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-1-thiomorpholin-4-ylpropan-1-one (PubChem CID 55868813) has the molecular formula C17H22N4O2S2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-1-thiomorpholin-4-ylpropan-1-one.
| Compound Name | 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-1-thiomorpholin-4-ylpropan-1-one |
|---|---|
| PubChem CID | 55868813 |
| Molecular Formula | C17H22N4O2S2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.12 |
| IUPAC Name | 3-[3-(4-ethoxyphenyl)-5-sulfanylidene-1H-1,2,4-triazol-4-yl]-1-thiomorpholin-4-ylpropan-1-one |
| SMILES | CCOc1ccc(-c2n[nH]c(=S)n2CCC(=O)N2CCSCC2)cc1 |
| InChI | InChI=1S/C17H22N4O2S2/c1-2-23-14-5-3-13(4-6-14)16-18-19-17(24)21(16)8-7-15(22)20-9-11-25-12-10-20/h3-6H,2,7-12H2,1H3,(H,19,24) |
| InChIKey | SGBOAZYWCUZVQO-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|