C20H25BrFN3O2S — CID 55870508
2-bromo-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-4-fluorobenzenesulfonamide (PubChem CID 55870508) has the molecular formula C20H25BrFN3O2S and a molecular weight of 470.41 g/mol. Its IUPAC name is 2-bromo-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-4-fluorobenzenesulfonamide.
| Compound Name | 2-bromo-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 55870508 |
| Molecular Formula | C20H25BrFN3O2S |
| Molecular Weight | 470.41 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 2-bromo-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-4-fluorobenzenesulfonamide |
| SMILES | CCN1CCN(Cc2ccccc2CNS(=O)(=O)c2ccc(F)cc2Br)CC1 |
| InChI | InChI=1S/C20H25BrFN3O2S/c1-2-24-9-11-25(12-10-24)15-17-6-4-3-5-16(17)14-23-28(26,27)20-8-7-18(22)13-19(20)21/h3-8,13,23H,2,9-12,14-15H2,1H3 |
| InChIKey | IAUVFYPGUJIPBE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.41 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |